C7H10N2O4S2 — CID 103862594
3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]propanoic acid (PubChem CID 103862594) has the molecular formula C7H10N2O4S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 103862594 |
| Molecular Formula | C7H10N2O4S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]propanoic acid |
| SMILES | Cc1ncc(S(=O)(=O)NCCC(=O)O)s1 |
| InChI | InChI=1S/C7H10N2O4S2/c1-5-8-4-7(14-5)15(12,13)9-3-2-6(10)11/h4,9H,2-3H2,1H3,(H,10,11) |
| InChIKey | XKMBYVTYXYLCMK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |