C9H14N2O4S2 — CID 104936317
4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid (PubChem CID 104936317) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid.
| Compound Name | 4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 104936317 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid |
| SMILES | Cc1ncc(S(=O)(=O)NC(C)CCC(=O)O)s1 |
| InChI | InChI=1S/C9H14N2O4S2/c1-6(3-4-8(12)13)11-17(14,15)9-5-10-7(2)16-9/h5-6,11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | QLBZINXEZWXAKT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |