C8H13BrN2O2S2 — CID 103416070
N-(1-bromobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103416070) has the molecular formula C8H13BrN2O2S2 and a molecular weight of 313.24 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(1-bromobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103416070 |
| Molecular Formula | C8H13BrN2O2S2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | N-(1-bromobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(CBr)NS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C8H13BrN2O2S2/c1-3-7(4-9)11-15(12,13)8-5-10-6(2)14-8/h5,7,11H,3-4H2,1-2H3 |
| InChIKey | XPJUPYIECJCGQV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|