C9H13N3O2S2 — CID 104694078
N-(1-cyanobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 104694078) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is N-(1-cyanobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(1-cyanobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 104694078 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-(1-cyanobutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(CC#N)NS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C9H13N3O2S2/c1-3-8(4-5-10)12-16(13,14)9-6-11-7(2)15-9/h6,8,12H,3-4H2,1-2H3 |
| InChIKey | HDNQAGRSVGCALK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |