C9H15BrN2O3S2 — CID 106158450
N-(4-bromo-1-methoxybutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 106158450) has the molecular formula C9H15BrN2O3S2 and a molecular weight of 343.27 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 106158450 |
| Molecular Formula | C9H15BrN2O3S2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | COCC(CCBr)NS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C9H15BrN2O3S2/c1-7-11-5-9(16-7)17(13,14)12-8(3-4-10)6-15-2/h5,8,12H,3-4,6H2,1-2H3 |
| InChIKey | WWJPNDXOPKZYMJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|