C11H14BrCl2NO3S — CID 114151678
N-(4-bromo-1-methoxybutan-2-yl)-3,4-dichlorobenzenesulfonamide (PubChem CID 114151678) has the molecular formula C11H14BrCl2NO3S and a molecular weight of 391.11 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114151678 |
| Molecular Formula | C11H14BrCl2NO3S |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-3,4-dichlorobenzenesulfonamide |
| SMILES | COCC(CCBr)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14BrCl2NO3S/c1-18-7-8(4-5-12)15-19(16,17)9-2-3-10(13)11(14)6-9/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | PCDFLXSUEYSVPJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|