C10H12BrCl2NO3S — CID 106185125
N-(1-bromo-3-methoxypropan-2-yl)-3,4-dichlorobenzenesulfonamide (PubChem CID 106185125) has the molecular formula C10H12BrCl2NO3S and a molecular weight of 377.09 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 106185125 |
| Molecular Formula | C10H12BrCl2NO3S |
| Molecular Weight | 377.09 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-3,4-dichlorobenzenesulfonamide |
| SMILES | COCC(CBr)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12BrCl2NO3S/c1-17-6-7(5-11)14-18(15,16)8-2-3-9(12)10(13)4-8/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | MTNIBZFKTVDQRH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|