C12H16Br2ClNO2S — CID 106613118
3-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-chlorobenzenesulfonamide (PubChem CID 106613118) has the molecular formula C12H16Br2ClNO2S and a molecular weight of 433.59 g/mol. Its IUPAC name is 3-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-chlorobenzenesulfonamide.
| Compound Name | 3-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 106613118 |
| Molecular Formula | C12H16Br2ClNO2S |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | 3-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-chlorobenzenesulfonamide |
| SMILES | CC(C)CC(CBr)NS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H16Br2ClNO2S/c1-8(2)5-9(7-13)16-19(17,18)10-3-4-12(15)11(14)6-10/h3-4,6,8-9,16H,5,7H2,1-2H3 |
| InChIKey | JQPLBUXJDLLJGR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|