C13H13BrClNO3S — CID 106611673
3-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide (PubChem CID 106611673) has the molecular formula C13H13BrClNO3S and a molecular weight of 378.68 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106611673 |
| Molecular Formula | C13H13BrClNO3S |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 3-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)c2ccc(Cl)c(Br)c2)o1 |
| InChI | InChI=1S/C13H13BrClNO3S/c1-8-3-6-13(19-8)9(2)16-20(17,18)10-4-5-12(15)11(14)7-10/h3-7,9,16H,1-2H3 |
| InChIKey | RLBGVISUYDKXIX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |