C14H16BrNO4S — CID 30964155
3-bromo-4-methoxy-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide (PubChem CID 30964155) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30964155 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 3-bromo-4-methoxy-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C)c2ccc(C)o2)cc1Br |
| InChI | InChI=1S/C14H16BrNO4S/c1-9-4-6-13(20-9)10(2)16-21(17,18)11-5-7-14(19-3)12(15)8-11/h4-8,10,16H,1-3H3/t10-/m1/s1 |
| InChIKey | RHYRVXNHUUDJRX-SNVBAGLBSA-N |
| XLogP | 3.40 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |