C14H22BrNO4S — CID 103270413
3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide (PubChem CID 103270413) has the molecular formula C14H22BrNO4S and a molecular weight of 380.30 g/mol. Its IUPAC name is 3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103270413 |
| Molecular Formula | C14H22BrNO4S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide |
| SMILES | CCOCC(NS(=O)(=O)c1ccc(OC)c(Br)c1)C(C)C |
| InChI | InChI=1S/C14H22BrNO4S/c1-5-20-9-13(10(2)3)16-21(17,18)11-6-7-14(19-4)12(15)8-11/h6-8,10,13,16H,5,9H2,1-4H3 |
| InChIKey | ZHYUJOKVYMCNBX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |