C14H22BrNO3S — CID 78966879
3-bromo-4-methoxy-N-(2,3,3-trimethylbutyl)benzenesulfonamide (PubChem CID 78966879) has the molecular formula C14H22BrNO3S and a molecular weight of 364.31 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-(2,3,3-trimethylbutyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78966879 |
| Molecular Formula | C14H22BrNO3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-bromo-4-methoxy-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(C)C(C)(C)C)cc1Br |
| InChI | InChI=1S/C14H22BrNO3S/c1-10(14(2,3)4)9-16-20(17,18)11-6-7-13(19-5)12(15)8-11/h6-8,10,16H,9H2,1-5H3 |
| InChIKey | ZTOXTKJJGUREJV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |