4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride

C13H20ClNO4S2 — CID 83142937

IUPAC4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride
SMILESCC(CNS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1)C(C)(C)C
InChIInChI=1S/C13H20ClNO4S2/c1-10(13(2,3)4)9-15-21(18,19)12-7-5-11(6-8-12)20(14,16)17/h5-8,10,15H,9H2,1-4H3
InChIKeyHXALYZAQIYDCIK-UHFFFAOYSA-N
MW353.89 g/mol
LogP2.57
Rot. Bonds5

About 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride

4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride (PubChem CID 83142937) has the molecular formula C13H20ClNO4S2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride
PubChem CID83142937
Molecular FormulaC13H20ClNO4S2
Molecular Weight353.89 g/mol
Exact Mass353.05
IUPAC Name4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride
SMILESCC(CNS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1)C(C)(C)C
InChIInChI=1S/C13H20ClNO4S2/c1-10(13(2,3)4)9-15-21(18,19)12-7-5-11(6-8-12)20(14,16)17/h5-8,10,15H,9H2,1-4H3
InChIKeyHXALYZAQIYDCIK-UHFFFAOYSA-N
XLogP2.57
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.89
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride?
The IUPAC name of 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride (CID 83142937) is 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride.
What is the SMILES notation for 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride?
The canonical SMILES for 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride is CC(CNS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1)C(C)(C)C.
What is the InChIKey of 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride?
The InChIKey is HXALYZAQIYDCIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClNO4S2/c1-10(13(2,3)4)9-15-21(18,19)12-7-5-11(6-8-12)20(14,16)17/h5-8,10,15H,9H2,1-4H3.
What are the key properties of 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride?
4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride has a molecular weight of 353.89 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride is sourced from PubChem (CID 83142937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).