C13H20ClNO4S2 — CID 83142937
4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride (PubChem CID 83142937) has the molecular formula C13H20ClNO4S2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 83142937 |
| Molecular Formula | C13H20ClNO4S2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-(2,3,3-trimethylbutylsulfamoyl)benzenesulfonyl chloride |
| SMILES | CC(CNS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1)C(C)(C)C |
| InChI | InChI=1S/C13H20ClNO4S2/c1-10(13(2,3)4)9-15-21(18,19)12-7-5-11(6-8-12)20(14,16)17/h5-8,10,15H,9H2,1-4H3 |
| InChIKey | HXALYZAQIYDCIK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |