C15H26N2O2S — CID 83143695
3-(1-aminoethyl)-N-(2,3,3-trimethylbutyl)benzenesulfonamide (PubChem CID 83143695) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-(1-aminoethyl)-N-(2,3,3-trimethylbutyl)benzenesulfonamide.
| Compound Name | 3-(1-aminoethyl)-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83143695 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-(1-aminoethyl)-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
| SMILES | CC(N)c1cccc(S(=O)(=O)NCC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H26N2O2S/c1-11(15(3,4)5)10-17-20(18,19)14-8-6-7-13(9-14)12(2)16/h6-9,11-12,17H,10,16H2,1-5H3 |
| InChIKey | IWVBSESSONKJBK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |