C12H16BrClN2O4S — CID 106612613
2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 106612613) has the molecular formula C12H16BrClN2O4S and a molecular weight of 399.69 g/mol. Its IUPAC name is 2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 106612613 |
| Molecular Formula | C12H16BrClN2O4S |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 2-[(3-bromo-4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)NS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H16BrClN2O4S/c1-8(12(17)15-5-6-20-2)16-21(18,19)9-3-4-11(14)10(13)7-9/h3-4,7-8,16H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | UMJTVUTVWUBITE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|