C13H17BrClNO4S — CID 106546567
tert-butyl (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 106546567) has the molecular formula C13H17BrClNO4S and a molecular weight of 398.71 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 106546567 |
| Molecular Formula | C13H17BrClNO4S |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | tert-butyl (2S)-2-[(3-bromo-4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Cl)c(Br)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H17BrClNO4S/c1-8(12(17)20-13(2,3)4)16-21(18,19)9-5-6-11(15)10(14)7-9/h5-8,16H,1-4H3/t8-/m0/s1 |
| InChIKey | YCWRXLZCVVWFDE-QMMMGPOBSA-N |
| XLogP | 3.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |