C12H18ClNO4S2 — CID 103100600
tert-butyl (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoate (PubChem CID 103100600) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 103100600 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | tert-butyl (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoate |
| SMILES | Cc1cc(S(=O)(=O)N[C@H](C)C(=O)OC(C)(C)C)sc1Cl |
| InChI | InChI=1S/C12H18ClNO4S2/c1-7-6-9(19-10(7)13)20(16,17)14-8(2)11(15)18-12(3,4)5/h6,8,14H,1-5H3/t8-/m1/s1 |
| InChIKey | DFAWTILKWPQEBX-MRVPVSSYSA-N |
| XLogP | 2.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |