C9H14ClNO3S2 — CID 103100218
5-chloro-N-(3-hydroxybutyl)-4-methylthiophene-2-sulfonamide (PubChem CID 103100218) has the molecular formula C9H14ClNO3S2 and a molecular weight of 283.80 g/mol. Its IUPAC name is 5-chloro-N-(3-hydroxybutyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3-hydroxybutyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100218 |
| Molecular Formula | C9H14ClNO3S2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 5-chloro-N-(3-hydroxybutyl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCC(C)O)sc1Cl |
| InChI | InChI=1S/C9H14ClNO3S2/c1-6-5-8(15-9(6)10)16(13,14)11-4-3-7(2)12/h5,7,11-12H,3-4H2,1-2H3 |
| InChIKey | DLZURUSUHYVBPJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |