C11H16ClNO3S — CID 64913110
4-chloro-N-(3-hydroxybutyl)-2-methylbenzenesulfonamide (PubChem CID 64913110) has the molecular formula C11H16ClNO3S and a molecular weight of 277.77 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxybutyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(3-hydroxybutyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 64913110 |
| Molecular Formula | C11H16ClNO3S |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-chloro-N-(3-hydroxybutyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCCC(C)O |
| InChI | InChI=1S/C11H16ClNO3S/c1-8-7-10(12)3-4-11(8)17(15,16)13-6-5-9(2)14/h3-4,7,9,13-14H,5-6H2,1-2H3 |
| InChIKey | YGFKORUXHMJJNR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |