C12H19ClN2O2S — CID 113282581
4-chloro-2-methyl-N-[2-methyl-3-(methylamino)propyl]benzenesulfonamide (PubChem CID 113282581) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-[2-methyl-3-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 4-chloro-2-methyl-N-[2-methyl-3-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113282581 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-chloro-2-methyl-N-[2-methyl-3-(methylamino)propyl]benzenesulfonamide |
| SMILES | CNCC(C)CNS(=O)(=O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C12H19ClN2O2S/c1-9(7-14-3)8-15-18(16,17)12-5-4-11(13)6-10(12)2/h4-6,9,14-15H,7-8H2,1-3H3 |
| InChIKey | VTSJYSFCQJESAJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |