C11H17ClN2O2S — CID 63730781
N-(2-aminobutyl)-4-chloro-2-methylbenzenesulfonamide (PubChem CID 63730781) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is N-(2-aminobutyl)-4-chloro-2-methylbenzenesulfonamide.
| Compound Name | N-(2-aminobutyl)-4-chloro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 63730781 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(2-aminobutyl)-4-chloro-2-methylbenzenesulfonamide |
| SMILES | CCC(N)CNS(=O)(=O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C11H17ClN2O2S/c1-3-10(13)7-14-17(15,16)11-5-4-9(12)6-8(11)2/h4-6,10,14H,3,7,13H2,1-2H3 |
| InChIKey | SZKOCBVSTXMIOQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |