C19H23ClN2O2S — CID 55689576
4-chloro-2-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzenesulfonamide (PubChem CID 55689576) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-chloro-2-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55689576 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-chloro-2-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C19H23ClN2O2S/c1-15-13-17(20)9-10-19(15)25(23,24)21-14-18(22-11-5-6-12-22)16-7-3-2-4-8-16/h2-4,7-10,13,18,21H,5-6,11-12,14H2,1H3 |
| InChIKey | AIQRFZQQBWASTG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |