C19H21F3N2O2S — CID 71881748
2,3,4-trifluoro-N-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide (PubChem CID 71881748) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71881748 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(CNS(=O)(=O)c2ccc(F)c(F)c2F)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H21F3N2O2S/c1-13-4-6-14(7-5-13)16(24-10-2-3-11-24)12-23-27(25,26)17-9-8-15(20)18(21)19(17)22/h4-9,16,23H,2-3,10-12H2,1H3 |
| InChIKey | DCUNBFRJUOBCRL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|