C20H25Cl2N3O2S — CID 43956534
2,5-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]benzenesulfonamide (PubChem CID 43956534) has the molecular formula C20H25Cl2N3O2S and a molecular weight of 442.41 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43956534 |
| Molecular Formula | C20H25Cl2N3O2S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2,5-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-pyrrolidin-1-ylethyl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)c2cc(Cl)ccc2Cl)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H25Cl2N3O2S/c1-24(2)17-8-5-15(6-9-17)19(25-11-3-4-12-25)14-23-28(26,27)20-13-16(21)7-10-18(20)22/h5-10,13,19,23H,3-4,11-12,14H2,1-2H3 |
| InChIKey | XEXCLENOZFHQLM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|