C24H25Cl2N3O2S — CID 43956613
2,5-dichloro-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzenesulfonamide (PubChem CID 43956613) has the molecular formula C24H25Cl2N3O2S and a molecular weight of 490.46 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43956613 |
| Molecular Formula | C24H25Cl2N3O2S |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2,5-dichloro-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)c2cc(Cl)ccc2Cl)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H25Cl2N3O2S/c1-28(2)20-10-7-18(8-11-20)23(29-14-13-17-5-3-4-6-22(17)29)16-27-32(30,31)24-15-19(25)9-12-21(24)26/h3-12,15,23,27H,13-14,16H2,1-2H3 |
| InChIKey | QNPJHGGPFMHNBC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|