C25H28FN3O2S — CID 27476571
N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-fluoro-3-methylbenzenesulfonamide (PubChem CID 27476571) has the molecular formula C25H28FN3O2S and a molecular weight of 453.58 g/mol. Its IUPAC name is N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-fluoro-3-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27476571 |
| Molecular Formula | C25H28FN3O2S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-fluoro-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC[C@H](c2ccc(N(C)C)cc2)N2CCc3ccccc32)ccc1F |
| InChI | InChI=1S/C25H28FN3O2S/c1-18-16-22(12-13-23(18)26)32(30,31)27-17-25(20-8-10-21(11-9-20)28(2)3)29-15-14-19-6-4-5-7-24(19)29/h4-13,16,25,27H,14-15,17H2,1-3H3/t25-/m1/s1 |
| InChIKey | UAFVRKYRQVGQSI-RUZDIDTESA-N |
| XLogP | 4.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|