C22H24ClN3O2S2 — CID 26792369
5-chloro-N-[(2R)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide (PubChem CID 26792369) has the molecular formula C22H24ClN3O2S2 and a molecular weight of 462.04 g/mol. Its IUPAC name is 5-chloro-N-[(2R)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2R)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26792369 |
| Molecular Formula | C22H24ClN3O2S2 |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 5-chloro-N-[(2R)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]thiophene-2-sulfonamide |
| SMILES | CN(C)c1ccc([C@H](CNS(=O)(=O)c2ccc(Cl)s2)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H24ClN3O2S2/c1-25(2)18-9-7-17(8-10-18)20(26-14-13-16-5-3-4-6-19(16)26)15-24-30(27,28)22-12-11-21(23)29-22/h3-12,20,24H,13-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | QRLMCCHGXRGTCD-FQEVSTJZSA-N |
| XLogP | 4.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|