C19H28N4O2S — CID 51499811
N-[(2S)-2-(azepan-1-yl)-2-phenylethyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 51499811) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[(2S)-2-(azepan-1-yl)-2-phenylethyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[(2S)-2-(azepan-1-yl)-2-phenylethyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 51499811 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[(2S)-2-(azepan-1-yl)-2-phenylethyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)NC[C@H](c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C19H28N4O2S/c1-16-19(15-22(2)21-16)26(24,25)20-14-18(17-10-6-5-7-11-17)23-12-8-3-4-9-13-23/h5-7,10-11,15,18,20H,3-4,8-9,12-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | ILEIFNNAOFXNKE-GOSISDBHSA-N |
| XLogP | 2.62 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |