C15H21N5O2S — CID 99789561
3-methyl-N-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]triazole-4-sulfonamide (PubChem CID 99789561) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-methyl-N-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]triazole-4-sulfonamide.
| Compound Name | 3-methyl-N-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]triazole-4-sulfonamide |
|---|---|
| PubChem CID | 99789561 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-methyl-N-[(2S)-2-phenyl-2-pyrrolidin-1-ylethyl]triazole-4-sulfonamide |
| SMILES | Cn1nncc1S(=O)(=O)NC[C@H](c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C15H21N5O2S/c1-19-15(12-16-18-19)23(21,22)17-11-14(20-9-5-6-10-20)13-7-3-2-4-8-13/h2-4,7-8,12,14,17H,5-6,9-11H2,1H3/t14-/m1/s1 |
| InChIKey | MAEVKXYWBQZRND-CQSZACIVSA-N |
| XLogP | 0.93 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |