C15H19ClN2O2S2 — CID 47031514
4-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-methylbenzenesulfonamide (PubChem CID 47031514) has the molecular formula C15H19ClN2O2S2 and a molecular weight of 358.92 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 47031514 |
| Molecular Formula | C15H19ClN2O2S2 |
| Molecular Weight | 358.92 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-chloro-N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCC(c1ccsc1)N(C)C |
| InChI | InChI=1S/C15H19ClN2O2S2/c1-11-8-13(16)4-5-15(11)22(19,20)17-9-14(18(2)3)12-6-7-21-10-12/h4-8,10,14,17H,9H2,1-3H3 |
| InChIKey | MJAIOZPXOIZASJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |