C17H24N2O2S2 — CID 16932771
N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 16932771) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 16932771 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NCC(c2ccsc2)N(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O2S2/c1-13(2)14-5-7-16(8-6-14)23(20,21)18-11-17(19(3)4)15-9-10-22-12-15/h5-10,12-13,17-18H,11H2,1-4H3 |
| InChIKey | MLNDIDLUFSGUGM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |