C7H10ClN3O3S2 — CID 103100630
2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxyethanimidamide (PubChem CID 103100630) has the molecular formula C7H10ClN3O3S2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 103100630 |
| Molecular Formula | C7H10ClN3O3S2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-N'-hydroxyethanimidamide |
| SMILES | Cc1cc(S(=O)(=O)NC/C(N)=N/O)sc1Cl |
| InChI | InChI=1S/C7H10ClN3O3S2/c1-4-2-6(15-7(4)8)16(13,14)10-3-5(9)11-12/h2,10,12H,3H2,1H3,(H2,9,11) |
| InChIKey | PQUOLYDCWJPQDI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|