C10H16Cl2N2O2S2 — CID 120712728
N-[(1-aminocyclobutyl)methyl]-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride (PubChem CID 120712728) has the molecular formula C10H16Cl2N2O2S2 and a molecular weight of 331.29 g/mol. Its IUPAC name is N-[(1-aminocyclobutyl)methyl]-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocyclobutyl)methyl]-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120712728 |
| Molecular Formula | C10H16Cl2N2O2S2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-[(1-aminocyclobutyl)methyl]-5-chloro-4-methylthiophene-2-sulfonamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)NCC2(N)CCC2)sc1Cl.Cl |
| InChI | InChI=1S/C10H15ClN2O2S2.ClH/c1-7-5-8(16-9(7)11)17(14,15)13-6-10(12)3-2-4-10;/h5,13H,2-4,6,12H2,1H3;1H |
| InChIKey | VZVMESNXBHLIMK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |