C12H20Cl2N2O2S2 — CID 119998693
N-[(1-aminocycloheptyl)methyl]-5-chlorothiophene-2-sulfonamide;hydrochloride (PubChem CID 119998693) has the molecular formula C12H20Cl2N2O2S2 and a molecular weight of 359.34 g/mol. Its IUPAC name is N-[(1-aminocycloheptyl)methyl]-5-chlorothiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocycloheptyl)methyl]-5-chlorothiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119998693 |
| Molecular Formula | C12H20Cl2N2O2S2 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[(1-aminocycloheptyl)methyl]-5-chlorothiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.NC1(CNS(=O)(=O)c2ccc(Cl)s2)CCCCCC1 |
| InChI | InChI=1S/C12H19ClN2O2S2.ClH/c13-10-5-6-11(18-10)19(16,17)15-9-12(14)7-3-1-2-4-8-12;/h5-6,15H,1-4,7-9,14H2;1H |
| InChIKey | MFGTYMAXNODGMP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |