C12H19ClN2O2S2 — CID 103100529
5-chloro-4-methyl-N-[(4-methylpiperidin-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 103100529) has the molecular formula C12H19ClN2O2S2 and a molecular weight of 322.88 g/mol. Its IUPAC name is 5-chloro-4-methyl-N-[(4-methylpiperidin-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-4-methyl-N-[(4-methylpiperidin-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100529 |
| Molecular Formula | C12H19ClN2O2S2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-chloro-4-methyl-N-[(4-methylpiperidin-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC2(C)CCNCC2)sc1Cl |
| InChI | InChI=1S/C12H19ClN2O2S2/c1-9-7-10(18-11(9)13)19(16,17)15-8-12(2)3-5-14-6-4-12/h7,14-15H,3-6,8H2,1-2H3 |
| InChIKey | BZYHEXXNWRTLIN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |