C11H17ClN2O2S2 — CID 103100386
5-chloro-4-methyl-N-(piperidin-4-ylmethyl)thiophene-2-sulfonamide (PubChem CID 103100386) has the molecular formula C11H17ClN2O2S2 and a molecular weight of 308.86 g/mol. Its IUPAC name is 5-chloro-4-methyl-N-(piperidin-4-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-4-methyl-N-(piperidin-4-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100386 |
| Molecular Formula | C11H17ClN2O2S2 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-chloro-4-methyl-N-(piperidin-4-ylmethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC2CCNCC2)sc1Cl |
| InChI | InChI=1S/C11H17ClN2O2S2/c1-8-6-10(17-11(8)12)18(15,16)14-7-9-2-4-13-5-3-9/h6,9,13-14H,2-5,7H2,1H3 |
| InChIKey | OIGGUSYIZNDQFU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |