C13H21ClN2O2S2 — CID 103100371
5-chloro-4-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide (PubChem CID 103100371) has the molecular formula C13H21ClN2O2S2 and a molecular weight of 336.91 g/mol. Its IUPAC name is 5-chloro-4-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-4-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100371 |
| Molecular Formula | C13H21ClN2O2S2 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 5-chloro-4-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C13H21ClN2O2S2/c1-3-8-16(11-4-6-15-7-5-11)20(17,18)12-9-10(2)13(14)19-12/h9,11,15H,3-8H2,1-2H3 |
| InChIKey | SEJYJTPOTDYTGM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |