C9H13ClN2O2S2 — CID 103100467
N-(azetidin-3-yl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide (PubChem CID 103100467) has the molecular formula C9H13ClN2O2S2 and a molecular weight of 280.80 g/mol. Its IUPAC name is N-(azetidin-3-yl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide.
| Compound Name | N-(azetidin-3-yl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100467 |
| Molecular Formula | C9H13ClN2O2S2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | N-(azetidin-3-yl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CNC2)sc1Cl |
| InChI | InChI=1S/C9H13ClN2O2S2/c1-6-3-8(15-9(6)10)16(13,14)12(2)7-4-11-5-7/h3,7,11H,4-5H2,1-2H3 |
| InChIKey | RRCLELZZPUEPQC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |