C12H19ClN2O2S2 — CID 103099464
N-(4-aminocyclohexyl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide (PubChem CID 103099464) has the molecular formula C12H19ClN2O2S2 and a molecular weight of 322.88 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103099464 |
| Molecular Formula | C12H19ClN2O2S2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-chloro-N,4-dimethylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CCC(N)CC2)sc1Cl |
| InChI | InChI=1S/C12H19ClN2O2S2/c1-8-7-11(18-12(8)13)19(16,17)15(2)10-5-3-9(14)4-6-10/h7,9-10H,3-6,14H2,1-2H3 |
| InChIKey | QHOJQEGWJMYMFC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |