C13H18Cl2N2O2S — CID 79120752
N-(4-aminocyclohexyl)-3,5-dichloro-N-methylbenzenesulfonamide (PubChem CID 79120752) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3,5-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-3,5-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79120752 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N-(4-aminocyclohexyl)-3,5-dichloro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCC(N)CC1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2S/c1-17(12-4-2-11(16)3-5-12)20(18,19)13-7-9(14)6-10(15)8-13/h6-8,11-12H,2-5,16H2,1H3 |
| InChIKey | OPSHJIVEABREEL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |