C13H17BrCl2N2O2S — CID 79113443
N-(4-aminocyclohexyl)-4-bromo-2,6-dichloro-N-methylbenzenesulfonamide (PubChem CID 79113443) has the molecular formula C13H17BrCl2N2O2S and a molecular weight of 416.17 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-bromo-2,6-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-4-bromo-2,6-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79113443 |
| Molecular Formula | C13H17BrCl2N2O2S |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-bromo-2,6-dichloro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCC(N)CC1)S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C13H17BrCl2N2O2S/c1-18(10-4-2-9(17)3-5-10)21(19,20)13-11(15)6-8(14)7-12(13)16/h6-7,9-10H,2-5,17H2,1H3 |
| InChIKey | IMUZYRIOKOAYQT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |