C13H19Cl2N3O2S — CID 43255890
2-amino-4,6-dichloro-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 43255890) has the molecular formula C13H19Cl2N3O2S and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43255890 |
| Molecular Formula | C13H19Cl2N3O2S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-amino-4,6-dichloro-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CN1CCC(N(C)S(=O)(=O)c2c(N)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H19Cl2N3O2S/c1-17-5-3-10(4-6-17)18(2)21(19,20)13-11(15)7-9(14)8-12(13)16/h7-8,10H,3-6,16H2,1-2H3 |
| InChIKey | PRXFZOARCMVSDD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|