C12H18Cl2N2O2S — CID 61114749
2-amino-4,6-dichloro-N-methyl-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 61114749) has the molecular formula C12H18Cl2N2O2S and a molecular weight of 325.26 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-methyl-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-methyl-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61114749 |
| Molecular Formula | C12H18Cl2N2O2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-amino-4,6-dichloro-N-methyl-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | CC(C)CCN(C)S(=O)(=O)c1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2O2S/c1-8(2)4-5-16(3)19(17,18)12-10(14)6-9(13)7-11(12)15/h6-8H,4-5,15H2,1-3H3 |
| InChIKey | SIFJEQQEIJMRDB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|