C14H25N3O2S — CID 107327900
4-hydrazinyl-N,2,6-trimethyl-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 107327900) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-hydrazinyl-N,2,6-trimethyl-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-N,2,6-trimethyl-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107327900 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-hydrazinyl-N,2,6-trimethyl-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)N(C)CCC(C)C |
| InChI | InChI=1S/C14H25N3O2S/c1-10(2)6-7-17(5)20(18,19)14-11(3)8-13(16-15)9-12(14)4/h8-10,16H,6-7,15H2,1-5H3 |
| InChIKey | PMFKVTGRFNQKQG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|