C13H23N3O3S — CID 107327994
4-hydrazinyl-N-(3-methoxypropyl)-N,2,6-trimethylbenzenesulfonamide (PubChem CID 107327994) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-hydrazinyl-N-(3-methoxypropyl)-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-(3-methoxypropyl)-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107327994 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-hydrazinyl-N-(3-methoxypropyl)-N,2,6-trimethylbenzenesulfonamide |
| SMILES | COCCCN(C)S(=O)(=O)c1c(C)cc(NN)cc1C |
| InChI | InChI=1S/C13H23N3O3S/c1-10-8-12(15-14)9-11(2)13(10)20(17,18)16(3)6-5-7-19-4/h8-9,15H,5-7,14H2,1-4H3 |
| InChIKey | DBEXTWVTDBEJHT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|