C11H17F2N3O2S — CID 107328167
N-(2,2-difluoroethyl)-4-hydrazinyl-N,2,6-trimethylbenzenesulfonamide (PubChem CID 107328167) has the molecular formula C11H17F2N3O2S and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-hydrazinyl-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-4-hydrazinyl-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107328167 |
| Molecular Formula | C11H17F2N3O2S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-hydrazinyl-N,2,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)N(C)CC(F)F |
| InChI | InChI=1S/C11H17F2N3O2S/c1-7-4-9(15-14)5-8(2)11(7)19(17,18)16(3)6-10(12)13/h4-5,10,15H,6,14H2,1-3H3 |
| InChIKey | FKDJDHROMBHCTQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|