C14H24N2O2S — CID 107328647
4-(ethylamino)-N,2,6-trimethyl-N-propylbenzenesulfonamide (PubChem CID 107328647) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-(ethylamino)-N,2,6-trimethyl-N-propylbenzenesulfonamide.
| Compound Name | 4-(ethylamino)-N,2,6-trimethyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 107328647 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-(ethylamino)-N,2,6-trimethyl-N-propylbenzenesulfonamide |
| SMILES | CCCN(C)S(=O)(=O)c1c(C)cc(NCC)cc1C |
| InChI | InChI=1S/C14H24N2O2S/c1-6-8-16(5)19(17,18)14-11(3)9-13(15-7-2)10-12(14)4/h9-10,15H,6-8H2,1-5H3 |
| InChIKey | KMCZRLWECBFYGR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |