C11H18N2O2S — CID 107328529
4-(ethylamino)-N,2,6-trimethylbenzenesulfonamide (PubChem CID 107328529) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-(ethylamino)-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | 4-(ethylamino)-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107328529 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(ethylamino)-N,2,6-trimethylbenzenesulfonamide |
| SMILES | CCNc1cc(C)c(S(=O)(=O)NC)c(C)c1 |
| InChI | InChI=1S/C11H18N2O2S/c1-5-13-10-6-8(2)11(9(3)7-10)16(14,15)12-4/h6-7,12-13H,5H2,1-4H3 |
| InChIKey | ZNWNDCYPPNZIHK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |