C15H25N3O2S — CID 107329086
4-(ethylamino)-2,6-dimethyl-N-piperidin-1-ylbenzenesulfonamide (PubChem CID 107329086) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 4-(ethylamino)-2,6-dimethyl-N-piperidin-1-ylbenzenesulfonamide.
| Compound Name | 4-(ethylamino)-2,6-dimethyl-N-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 107329086 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-(ethylamino)-2,6-dimethyl-N-piperidin-1-ylbenzenesulfonamide |
| SMILES | CCNc1cc(C)c(S(=O)(=O)NN2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C15H25N3O2S/c1-4-16-14-10-12(2)15(13(3)11-14)21(19,20)17-18-8-6-5-7-9-18/h10-11,16-17H,4-9H2,1-3H3 |
| InChIKey | SBRJLKYWUBSHGO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |