C13H21N3O2S — CID 83012282
2-amino-4,5-dimethyl-N-piperidin-1-ylbenzenesulfonamide (PubChem CID 83012282) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-N-piperidin-1-ylbenzenesulfonamide.
| Compound Name | 2-amino-4,5-dimethyl-N-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 83012282 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-amino-4,5-dimethyl-N-piperidin-1-ylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(S(=O)(=O)NN2CCCCC2)cc1C |
| InChI | InChI=1S/C13H21N3O2S/c1-10-8-12(14)13(9-11(10)2)19(17,18)15-16-6-4-3-5-7-16/h8-9,15H,3-7,14H2,1-2H3 |
| InChIKey | RCXLLXYOZKVMFV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|